C34H32N4O11S — CID 86747079
(2E)-2-[2-benzhydryloxy-1-(3,4-diacetyloxyphenyl)-2-oxoethoxy]imino-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]acetic acid (PubChem CID 86747079) has the molecular formula C34H32N4O11S and a molecular weight of 704.71 g/mol. Its IUPAC name is (2E)-2-[2-benzhydryloxy-1-(3,4-diacetyloxyphenyl)-2-oxoethoxy]imino-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]acetic acid.
| Compound Name | (2E)-2-[2-benzhydryloxy-1-(3,4-diacetyloxyphenyl)-2-oxoethoxy]imino-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 86747079 |
| Molecular Formula | C34H32N4O11S |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | (2E)-2-[2-benzhydryloxy-1-(3,4-diacetyloxyphenyl)-2-oxoethoxy]imino-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]acetic acid |
| SMILES | CC(=O)Oc1ccc(C(O/N=C(/C(=O)O)c2nsc(NC(=O)OC(C)(C)C)n2)C(=O)OC(c2ccccc2)c2ccccc2)cc1OC(C)=O |
| InChI | InChI=1S/C34H32N4O11S/c1-19(39)45-24-17-16-23(18-25(24)46-20(2)40)28(31(43)47-27(21-12-8-6-9-13-21)22-14-10-7-11-15-22)49-37-26(30(41)42)29-35-32(50-38-29)36-33(44)48-34(3,4)5/h6-18,27-28H,1-5H3,(H,41,42)(H,35,36,38,44)/b37-26+ |
| InChIKey | NFRMIRFKUGPFRQ-AVLPFNLUSA-N |
| XLogP | 5.62 |
| TPSA | 201.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|