C16H24N4O7S2 — CID 19746669
(2Z)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-1-methylsulfanyl-2-oxoethoxy]iminoacetic acid (PubChem CID 19746669) has the molecular formula C16H24N4O7S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2Z)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-1-methylsulfanyl-2-oxoethoxy]iminoacetic acid.
| Compound Name | (2Z)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-1-methylsulfanyl-2-oxoethoxy]iminoacetic acid |
|---|---|
| PubChem CID | 19746669 |
| Molecular Formula | C16H24N4O7S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (2Z)-2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,2,4-thiadiazol-3-yl]-2-[2-[(2-methylpropan-2-yl)oxy]-1-methylsulfanyl-2-oxoethoxy]iminoacetic acid |
| SMILES | CSC(O/N=C(\C(=O)O)c1nsc(NC(=O)OC(C)(C)C)n1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N4O7S2/c1-15(2,3)25-11(23)12(28-7)27-19-8(10(21)22)9-17-13(29-20-9)18-14(24)26-16(4,5)6/h12H,1-7H3,(H,21,22)(H,17,18,20,24)/b19-8- |
| InChIKey | XAPDXPGEDOQDBA-UWVJOHFNSA-N |
| XLogP | 2.72 |
| TPSA | 149.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|