C28H29N3O7S — CID 139562104
(2Z)-2-(1-benzhydryloxycarbonylcyclobutyl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 139562104) has the molecular formula C28H29N3O7S and a molecular weight of 551.62 g/mol. Its IUPAC name is (2Z)-2-(1-benzhydryloxycarbonylcyclobutyl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-(1-benzhydryloxycarbonylcyclobutyl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 139562104 |
| Molecular Formula | C28H29N3O7S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | (2Z)-2-(1-benzhydryloxycarbonylcyclobutyl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N/OC2(C(=O)OC(c3ccccc3)c3ccccc3)CCC2)C(=O)O)cs1 |
| InChI | InChI=1S/C28H29N3O7S/c1-27(2,3)37-26(35)30-25-29-20(17-39-25)21(23(32)33)31-38-28(15-10-16-28)24(34)36-22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,17,22H,10,15-16H2,1-3H3,(H,32,33)(H,29,30,35)/b31-21- |
| InChIKey | KZKVDKFUBHBAHN-YQYKVWLJSA-N |
| XLogP | 5.55 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|