C31H28N6O4S — CID 139839510
tert-butyl N-[4-[(Z)-C-(1,2,4-triazole-1-carbonyl)-N-trityloxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 139839510) has the molecular formula C31H28N6O4S and a molecular weight of 580.67 g/mol. Its IUPAC name is tert-butyl N-[4-[(Z)-C-(1,2,4-triazole-1-carbonyl)-N-trityloxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(Z)-C-(1,2,4-triazole-1-carbonyl)-N-trityloxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 139839510 |
| Molecular Formula | C31H28N6O4S |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | tert-butyl N-[4-[(Z)-C-(1,2,4-triazole-1-carbonyl)-N-trityloxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N/OC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)n2cncn2)cs1 |
| InChI | InChI=1S/C31H28N6O4S/c1-30(2,3)40-29(39)35-28-34-25(19-42-28)26(27(38)37-21-32-20-33-37)36-41-31(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-21H,1-3H3,(H,34,35,39)/b36-26- |
| InChIKey | XQYWEMWQZZNUHS-QYVLQNAGSA-N |
| XLogP | 6.13 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|