C18H28ClN3O6S — CID 155179392
tert-butyl N-[4-[(Z)-C-carbonochloridoyl-N-[1-hydroxy-2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 155179392) has the molecular formula C18H28ClN3O6S and a molecular weight of 449.96 g/mol. Its IUPAC name is tert-butyl N-[4-[(Z)-C-carbonochloridoyl-N-[1-hydroxy-2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(Z)-C-carbonochloridoyl-N-[1-hydroxy-2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 155179392 |
| Molecular Formula | C18H28ClN3O6S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | tert-butyl N-[4-[(Z)-C-carbonochloridoyl-N-[1-hydroxy-2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycarbonimidoyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(/C(=N/OC(C)(C)C(O)OC(C)(C)C)C(=O)Cl)cs1 |
| InChI | InChI=1S/C18H28ClN3O6S/c1-16(2,3)26-13(24)18(7,8)28-22-11(12(19)23)10-9-29-14(20-10)21-15(25)27-17(4,5)6/h9,13,24H,1-8H3,(H,20,21,25)/b22-11- |
| InChIKey | RHKDSQHQRIKUEM-JJFYIABZSA-N |
| XLogP | 3.89 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|