C18H27N3O7S — CID 131977206
(2Z)-2-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 131977206) has the molecular formula C18H27N3O7S and a molecular weight of 429.50 g/mol. Its IUPAC name is (2Z)-2-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 131977206 |
| Molecular Formula | C18H27N3O7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2Z)-2-(1-butoxy-2-methyl-1-oxopropan-2-yl)oxyimino-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCCOC(=O)C(C)(C)O/N=C(\C(=O)O)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H27N3O7S/c1-7-8-9-26-14(24)18(5,6)28-21-12(13(22)23)11-10-29-15(19-11)20-16(25)27-17(2,3)4/h10H,7-9H2,1-6H3,(H,22,23)(H,19,20,25)/b21-12- |
| InChIKey | VCCTYMMPYMVXSW-MTJSOVHGSA-N |
| XLogP | 3.42 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|