C33H37N3O5SSi — CID 54448635
2-[2-methyl-1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 54448635) has the molecular formula C33H37N3O5SSi and a molecular weight of 615.83 g/mol. Its IUPAC name is 2-[2-methyl-1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-methyl-1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 54448635 |
| Molecular Formula | C33H37N3O5SSi |
| Molecular Weight | 615.83 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | 2-[2-methyl-1-oxo-1-(2-trimethylsilylethoxy)propan-2-yl]oxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(C)(ON=C(C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C33H37N3O5SSi/c1-32(2,30(39)40-21-22-43(3,4)5)41-36-28(29(37)38)27-23-42-31(34-27)35-33(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23H,21-22H2,1-5H3,(H,34,35)(H,37,38) |
| InChIKey | WTISPZMIBDXFOW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.83 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|