C22H27N5O8S — CID 135387440
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-[2-oxo-2-[2-(phenylmethoxycarbonylamino)ethylamino]ethoxy]iminoacetic acid (PubChem CID 135387440) has the molecular formula C22H27N5O8S and a molecular weight of 521.55 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-[2-oxo-2-[2-(phenylmethoxycarbonylamino)ethylamino]ethoxy]iminoacetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-[2-oxo-2-[2-(phenylmethoxycarbonylamino)ethylamino]ethoxy]iminoacetic acid |
|---|---|
| PubChem CID | 135387440 |
| Molecular Formula | C22H27N5O8S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-[2-oxo-2-[2-(phenylmethoxycarbonylamino)ethylamino]ethoxy]iminoacetic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(=NOCC(=O)NCCNC(=O)OCc2ccccc2)C(=O)O)cs1 |
| InChI | InChI=1S/C22H27N5O8S/c1-22(2,3)35-21(32)26-19-25-15(13-36-19)17(18(29)30)27-34-12-16(28)23-9-10-24-20(31)33-11-14-7-5-4-6-8-14/h4-8,13H,9-12H2,1-3H3,(H,23,28)(H,24,31)(H,29,30)(H,25,26,32) |
| InChIKey | SJABGQYTOXLBQY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|