C27H22N6O2S — CID 139839497
(2Z)-2-methoxyimino-1-(1,2,4-triazol-1-yl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]ethanone (PubChem CID 139839497) has the molecular formula C27H22N6O2S and a molecular weight of 494.58 g/mol. Its IUPAC name is (2Z)-2-methoxyimino-1-(1,2,4-triazol-1-yl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]ethanone.
| Compound Name | (2Z)-2-methoxyimino-1-(1,2,4-triazol-1-yl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 139839497 |
| Molecular Formula | C27H22N6O2S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (2Z)-2-methoxyimino-1-(1,2,4-triazol-1-yl)-2-[2-(tritylamino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CO/N=C(\C(=O)n1cncn1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C27H22N6O2S/c1-35-32-24(25(34)33-19-28-18-29-33)23-17-36-26(30-23)31-27(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-19H,1H3,(H,30,31)/b32-24- |
| InChIKey | SRZLHMUNCKHGMD-TZHWMEPESA-N |
| XLogP | 4.83 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|