C8H10Cl2N4O4S — CID 131737859
2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;hydrochloride (PubChem CID 131737859) has the molecular formula C8H10Cl2N4O4S and a molecular weight of 329.17 g/mol. Its IUPAC name is 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;hydrochloride.
| Compound Name | 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 131737859 |
| Molecular Formula | C8H10Cl2N4O4S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;hydrochloride |
| SMILES | CC(C)(O/N=C(/C(=O)Cl)c1nsc(N)n1)C(=O)O.Cl |
| InChI | InChI=1S/C8H9ClN4O4S.ClH/c1-8(2,6(15)16)17-12-3(4(9)14)5-11-7(10)18-13-5;/h1-2H3,(H,15,16)(H2,10,11,13);1H/b12-3-; |
| InChIKey | CLOSIVXXYRKFMT-RZDFXPFOSA-N |
| XLogP | 0.89 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|