C6H8N4O2S — CID 91057272
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethyliminoacetic acid (PubChem CID 91057272) has the molecular formula C6H8N4O2S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethyliminoacetic acid.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethyliminoacetic acid |
|---|---|
| PubChem CID | 91057272 |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethyliminoacetic acid |
| SMILES | CC/N=C(\C(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C6H8N4O2S/c1-2-8-3(5(11)12)4-9-6(7)13-10-4/h2H2,1H3,(H,11,12)(H2,7,9,10)/b8-3- |
| InChIKey | KHZXCURUXQKFEU-BAQGIRSFSA-N |
| XLogP | 0.01 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|