2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid

C10H16N4O3S — CID 139612213

IUPAC2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid
SMILESCCCCCCON=C(C(=O)O)c1nsc(N)n1
InChIInChI=1S/C10H16N4O3S/c1-2-3-4-5-6-17-13-7(9(15)16)8-12-10(11)18-14-8/h2-6H2,1H3,(H,15,16)(H2,11,12,14)
InChIKeyBXFBVTHMJOEAKN-UHFFFAOYSA-N
MW272.33 g/mol
LogP1.51
Rot. Bonds8

About 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid

2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid (PubChem CID 139612213) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid.

Molecular Properties

Compound Name2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid
PubChem CID139612213
Molecular FormulaC10H16N4O3S
Molecular Weight272.33 g/mol
Exact Mass272.09
IUPAC Name2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid
SMILESCCCCCCON=C(C(=O)O)c1nsc(N)n1
InChIInChI=1S/C10H16N4O3S/c1-2-3-4-5-6-17-13-7(9(15)16)8-12-10(11)18-14-8/h2-6H2,1H3,(H,15,16)(H2,11,12,14)
InChIKeyBXFBVTHMJOEAKN-UHFFFAOYSA-N
XLogP1.51
TPSA110.69 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.33
LogP ≤ 51.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid?
The IUPAC name of 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid (CID 139612213) is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid.
What is the SMILES notation for 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid?
The canonical SMILES for 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid is CCCCCCON=C(C(=O)O)c1nsc(N)n1.
What is the InChIKey of 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid?
The InChIKey is BXFBVTHMJOEAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3S/c1-2-3-4-5-6-17-13-7(9(15)16)8-12-10(11)18-14-8/h2-6H2,1H3,(H,15,16)(H2,11,12,14).
What are the key properties of 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid?
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid has a molecular weight of 272.33 g/mol, XLogP of 1.51, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid is sourced from PubChem (CID 139612213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).