C10H16N4O3S — CID 139612213
2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid (PubChem CID 139612213) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid |
|---|---|
| PubChem CID | 139612213 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hexoxyiminoacetic acid |
| SMILES | CCCCCCON=C(C(=O)O)c1nsc(N)n1 |
| InChI | InChI=1S/C10H16N4O3S/c1-2-3-4-5-6-17-13-7(9(15)16)8-12-10(11)18-14-8/h2-6H2,1H3,(H,15,16)(H2,11,12,14) |
| InChIKey | BXFBVTHMJOEAKN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|