About 2-dodecoxyguanidine
2-dodecoxyguanidine (PubChem CID 158305776) has the molecular formula C13H29N3O
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-dodecoxyguanidine.
Molecular Properties
| Compound Name | 2-dodecoxyguanidine |
| PubChem CID | 158305776 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2-dodecoxyguanidine |
| SMILES | CCCCCCCCCCCCON=C(N)N |
| InChI | InChI=1S/C13H29N3O/c1-2-3-4-5-6-7-8-9-10-11-12-17-16-13(14)15/h2-12H2,1H3,(H4,14,15,16) |
| InChIKey | GNBGRIWCKRXBOP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-dodecoxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dodecoxyguanidine?
The IUPAC name of 2-dodecoxyguanidine (CID 158305776) is 2-dodecoxyguanidine.
What is the SMILES notation for 2-dodecoxyguanidine?
The canonical SMILES for 2-dodecoxyguanidine is CCCCCCCCCCCCON=C(N)N.
What is the InChIKey of 2-dodecoxyguanidine?
The InChIKey is GNBGRIWCKRXBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3O/c1-2-3-4-5-6-7-8-9-10-11-12-17-16-13(14)15/h2-12H2,1H3,(H4,14,15,16).
What are the key properties of 2-dodecoxyguanidine?
2-dodecoxyguanidine has a molecular weight of 243.39 g/mol, XLogP of 3.11, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dodecoxyguanidine is sourced from PubChem (CID 158305776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).