About N-hexoxypropan-2-imine;N-pentoxypropan-2-imine
N-hexoxypropan-2-imine;N-pentoxypropan-2-imine (PubChem CID 91028134) has the molecular formula C17H36N2O2
and a molecular weight of 300.49 g/mol. Its IUPAC name is N-hexoxypropan-2-imine;N-pentoxypropan-2-imine.
Molecular Properties
| Compound Name | N-hexoxypropan-2-imine;N-pentoxypropan-2-imine |
| PubChem CID | 91028134 |
| Molecular Formula | C17H36N2O2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | N-hexoxypropan-2-imine;N-pentoxypropan-2-imine |
| SMILES | CCCCCCON=C(C)C.CCCCCON=C(C)C |
| InChI | InChI=1S/C9H19NO.C8H17NO/c1-4-5-6-7-8-11-10-9(2)3;1-4-5-6-7-10-9-8(2)3/h4-8H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | UVFSFXVERJHMAE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hexoxypropan-2-imine;N-pentoxypropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexoxypropan-2-imine;N-pentoxypropan-2-imine?
The IUPAC name of N-hexoxypropan-2-imine;N-pentoxypropan-2-imine (CID 91028134) is N-hexoxypropan-2-imine;N-pentoxypropan-2-imine.
What is the SMILES notation for N-hexoxypropan-2-imine;N-pentoxypropan-2-imine?
The canonical SMILES for N-hexoxypropan-2-imine;N-pentoxypropan-2-imine is CCCCCCON=C(C)C.CCCCCON=C(C)C.
What is the InChIKey of N-hexoxypropan-2-imine;N-pentoxypropan-2-imine?
The InChIKey is UVFSFXVERJHMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C8H17NO/c1-4-5-6-7-8-11-10-9(2)3;1-4-5-6-7-10-9-8(2)3/h4-8H2,1-3H3;4-7H2,1-3H3.
What are the key properties of N-hexoxypropan-2-imine;N-pentoxypropan-2-imine?
N-hexoxypropan-2-imine;N-pentoxypropan-2-imine has a molecular weight of 300.49 g/mol, XLogP of 5.57, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexoxypropan-2-imine;N-pentoxypropan-2-imine is sourced from PubChem (CID 91028134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).