About 2-decoxyguanidine
2-decoxyguanidine (PubChem CID 154161085) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-decoxyguanidine.
Molecular Properties
| Compound Name | 2-decoxyguanidine |
| PubChem CID | 154161085 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 2-decoxyguanidine |
| SMILES | CCCCCCCCCCON=C(N)N |
| InChI | InChI=1S/C11H25N3O/c1-2-3-4-5-6-7-8-9-10-15-14-11(12)13/h2-10H2,1H3,(H4,12,13,14) |
| InChIKey | PUNHFCPQTFYUAW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-decoxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decoxyguanidine?
The IUPAC name of 2-decoxyguanidine (CID 154161085) is 2-decoxyguanidine.
What is the SMILES notation for 2-decoxyguanidine?
The canonical SMILES for 2-decoxyguanidine is CCCCCCCCCCON=C(N)N.
What is the InChIKey of 2-decoxyguanidine?
The InChIKey is PUNHFCPQTFYUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O/c1-2-3-4-5-6-7-8-9-10-15-14-11(12)13/h2-10H2,1H3,(H4,12,13,14).
What are the key properties of 2-decoxyguanidine?
2-decoxyguanidine has a molecular weight of 215.34 g/mol, XLogP of 2.33, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decoxyguanidine is sourced from PubChem (CID 154161085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).