C12H24CoN2O2 — CID 174757879
cobalt;2-N,3-N-dibutoxybutane-2,3-diimine (PubChem CID 174757879) has the molecular formula C12H24CoN2O2 and a molecular weight of 287.27 g/mol. Its IUPAC name is cobalt;2-N,3-N-dibutoxybutane-2,3-diimine.
| Compound Name | cobalt;2-N,3-N-dibutoxybutane-2,3-diimine |
|---|---|
| PubChem CID | 174757879 |
| Molecular Formula | C12H24CoN2O2 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | cobalt;2-N,3-N-dibutoxybutane-2,3-diimine |
| SMILES | CCCCO/N=C(C)/C(C)=N/OCCCC.[Co] |
| InChI | InChI=1S/C12H24N2O2.Co/c1-5-7-9-15-13-11(3)12(4)14-16-10-8-6-2;/h5-10H2,1-4H3;/b13-11+,14-12+; |
| InChIKey | PVZWHEWVIOJYIK-JZOPPWQGSA-N |
| XLogP | 3.37 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|