C7H8ClN3O3S — CID 54314875
2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-ethoxyiminoacetic acid (PubChem CID 54314875) has the molecular formula C7H8ClN3O3S and a molecular weight of 249.68 g/mol. Its IUPAC name is 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-ethoxyiminoacetic acid.
| Compound Name | 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-ethoxyiminoacetic acid |
|---|---|
| PubChem CID | 54314875 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 249.68 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-ethoxyiminoacetic acid |
| SMILES | CCON=C(C(=O)O)c1nc(N)sc1Cl |
| InChI | InChI=1S/C7H8ClN3O3S/c1-2-14-11-4(6(12)13)3-5(8)15-7(9)10-3/h2H2,1H3,(H2,9,10)(H,12,13) |
| InChIKey | SNLYLTDNBRROTC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.68 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|