C8H10ClN3O2S — CID 173351801
(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetaldehyde (PubChem CID 173351801) has the molecular formula C8H10ClN3O2S and a molecular weight of 247.71 g/mol. Its IUPAC name is (2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetaldehyde.
| Compound Name | (2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetaldehyde |
|---|---|
| PubChem CID | 173351801 |
| Molecular Formula | C8H10ClN3O2S |
| Molecular Weight | 247.71 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetaldehyde |
| SMILES | CCCO/N=C(\C=O)c1nc(N)sc1Cl |
| InChI | InChI=1S/C8H10ClN3O2S/c1-2-3-14-12-5(4-13)6-7(9)15-8(10)11-6/h4H,2-3H2,1H3,(H2,10,11)/b12-5+ |
| InChIKey | GKCQCZQZIWTDSF-LFYBBSHMSA-N |
| XLogP | 1.71 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|