C12H14ClN3O5S — CID 57266732
tert-butyl 2-[[1-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate (PubChem CID 57266732) has the molecular formula C12H14ClN3O5S and a molecular weight of 347.78 g/mol. Its IUPAC name is tert-butyl 2-[[1-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate.
| Compound Name | tert-butyl 2-[[1-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 57266732 |
| Molecular Formula | C12H14ClN3O5S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | tert-butyl 2-[[1-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate |
| SMILES | CC(C)(C)OC(=O)CON=C(C=O)c1nc(NC=O)sc1Cl |
| InChI | InChI=1S/C12H14ClN3O5S/c1-12(2,3)21-8(19)5-20-16-7(4-17)9-10(13)22-11(15-9)14-6-18/h4,6H,5H2,1-3H3,(H,14,15,18) |
| InChIKey | UETPLEWYUCSNIY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|