C14H16ClN3O6S — CID 88752945
2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-[(Z)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-1-enoxy]iminoacetic acid (PubChem CID 88752945) has the molecular formula C14H16ClN3O6S and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-[(Z)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-1-enoxy]iminoacetic acid.
| Compound Name | 2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-[(Z)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-1-enoxy]iminoacetic acid |
|---|---|
| PubChem CID | 88752945 |
| Molecular Formula | C14H16ClN3O6S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-(5-chloro-2-formamido-1,3-thiazol-4-yl)-2-[(Z)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-1-enoxy]iminoacetic acid |
| SMILES | CC(C)(C)OC(=O)C/C=C\ON=C(C(=O)O)c1nc(NC=O)sc1Cl |
| InChI | InChI=1S/C14H16ClN3O6S/c1-14(2,3)24-8(20)5-4-6-23-18-10(12(21)22)9-11(15)25-13(17-9)16-7-19/h4,6-7H,5H2,1-3H3,(H,21,22)(H,16,17,19)/b6-4-,18-10? |
| InChIKey | MIXTZEQOTKCPMJ-AMQSJSHASA-N |
| XLogP | 2.42 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|