C10H15ClN4O3S — CID 90860149
(2E)-2-[5-chloro-2-(methylamino)-1,3-thiazol-4-yl]-2-[3-(methylamino)propoxyimino]acetic acid (PubChem CID 90860149) has the molecular formula C10H15ClN4O3S and a molecular weight of 306.78 g/mol. Its IUPAC name is (2E)-2-[5-chloro-2-(methylamino)-1,3-thiazol-4-yl]-2-[3-(methylamino)propoxyimino]acetic acid.
| Compound Name | (2E)-2-[5-chloro-2-(methylamino)-1,3-thiazol-4-yl]-2-[3-(methylamino)propoxyimino]acetic acid |
|---|---|
| PubChem CID | 90860149 |
| Molecular Formula | C10H15ClN4O3S |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (2E)-2-[5-chloro-2-(methylamino)-1,3-thiazol-4-yl]-2-[3-(methylamino)propoxyimino]acetic acid |
| SMILES | CNCCCO/N=C(/C(=O)O)c1nc(NC)sc1Cl |
| InChI | InChI=1S/C10H15ClN4O3S/c1-12-4-3-5-18-15-7(9(16)17)6-8(11)19-10(13-2)14-6/h12H,3-5H2,1-2H3,(H,13,14)(H,16,17)/b15-7+ |
| InChIKey | WAJWZGXXUIDYAI-VIZOYTHASA-N |
| XLogP | 1.25 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|