C8H10ClN3O3S — CID 173070149
2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid (PubChem CID 173070149) has the molecular formula C8H10ClN3O3S and a molecular weight of 263.71 g/mol. Its IUPAC name is 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid.
| Compound Name | 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid |
|---|---|
| PubChem CID | 173070149 |
| Molecular Formula | C8H10ClN3O3S |
| Molecular Weight | 263.71 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-propoxyiminoacetic acid |
| SMILES | CCCON=C(C(=O)O)c1nc(N)sc1Cl |
| InChI | InChI=1S/C8H10ClN3O3S/c1-2-3-15-12-5(7(13)14)4-6(9)16-8(10)11-4/h2-3H2,1H3,(H2,10,11)(H,13,14) |
| InChIKey | BGMJCZSYQHOXRE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|