C7H8Cl3N4O3PS — CID 18601066
(2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-propoxyiminoacetyl chloride (PubChem CID 18601066) has the molecular formula C7H8Cl3N4O3PS and a molecular weight of 365.57 g/mol. Its IUPAC name is (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-propoxyiminoacetyl chloride.
| Compound Name | (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-propoxyiminoacetyl chloride |
|---|---|
| PubChem CID | 18601066 |
| Molecular Formula | C7H8Cl3N4O3PS |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-propoxyiminoacetyl chloride |
| SMILES | CCCO/N=C(/C(=O)Cl)c1nsc(NP(=O)(Cl)Cl)n1 |
| InChI | InChI=1S/C7H8Cl3N4O3PS/c1-2-3-17-12-4(5(8)15)6-11-7(19-14-6)13-18(9,10)16/h2-3H2,1H3,(H,11,13,14,16)/b12-4- |
| InChIKey | BLPJOMKQYULDJH-QCDXTXTGSA-N |
| XLogP | 3.43 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|