C8H12N4NaO6PS — CID 23707439
sodium (2Z)-2-[5-(dimethoxyphosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate (PubChem CID 23707439) has the molecular formula C8H12N4NaO6PS and a molecular weight of 346.24 g/mol. Its IUPAC name is sodium (2Z)-2-[5-(dimethoxyphosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate.
| Compound Name | sodium (2Z)-2-[5-(dimethoxyphosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate |
|---|---|
| PubChem CID | 23707439 |
| Molecular Formula | C8H12N4NaO6PS |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | sodium (2Z)-2-[5-(dimethoxyphosphorylamino)-1,2,4-thiadiazol-3-yl]-2-ethoxyiminoacetate |
| SMILES | CCO/N=C(\C(=O)[O-])c1nsc(NP(=O)(OC)OC)n1.[Na+] |
| InChI | InChI=1S/C8H13N4O6PS.Na/c1-4-18-10-5(7(13)14)6-9-8(20-12-6)11-19(15,16-2)17-3;/h4H2,1-3H3,(H,13,14)(H,9,11,12,15);/q;+1/p-1/b10-5-; |
| InChIKey | YGIWVXAOKQRBIE-WIMVAJRLSA-M |
| XLogP | -3.15 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|