C6H8ClN4O3PS — CID 118901322
(2Z)-2-ethoxyimino-2-[5-(phosphanyloxyamino)-1,2,4-thiadiazol-3-yl]acetyl chloride (PubChem CID 118901322) has the molecular formula C6H8ClN4O3PS and a molecular weight of 282.65 g/mol. Its IUPAC name is (2Z)-2-ethoxyimino-2-[5-(phosphanyloxyamino)-1,2,4-thiadiazol-3-yl]acetyl chloride.
| Compound Name | (2Z)-2-ethoxyimino-2-[5-(phosphanyloxyamino)-1,2,4-thiadiazol-3-yl]acetyl chloride |
|---|---|
| PubChem CID | 118901322 |
| Molecular Formula | C6H8ClN4O3PS |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | (2Z)-2-ethoxyimino-2-[5-(phosphanyloxyamino)-1,2,4-thiadiazol-3-yl]acetyl chloride |
| SMILES | CCO/N=C(\C(=O)Cl)c1nsc(NOP)n1 |
| InChI | InChI=1S/C6H8ClN4O3PS/c1-2-13-9-3(4(7)12)5-8-6(10-14-15)16-11-5/h2,15H2,1H3,(H,8,10,11)/b9-3+ |
| InChIKey | XFDHGXGPJJKMAA-YCRREMRBSA-N |
| XLogP | 1.18 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|