C5H3Cl3FN4O3PS — CID 87585420
(2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-(fluoromethoxyimino)acetyl chloride (PubChem CID 87585420) has the molecular formula C5H3Cl3FN4O3PS and a molecular weight of 355.50 g/mol. Its IUPAC name is (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-(fluoromethoxyimino)acetyl chloride.
| Compound Name | (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-(fluoromethoxyimino)acetyl chloride |
|---|---|
| PubChem CID | 87585420 |
| Molecular Formula | C5H3Cl3FN4O3PS |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 353.87 |
| IUPAC Name | (2E)-2-[5-(dichlorophosphorylamino)-1,2,4-thiadiazol-3-yl]-2-(fluoromethoxyimino)acetyl chloride |
| SMILES | O=C(Cl)/C(=N/OCF)c1nsc(NP(=O)(Cl)Cl)n1 |
| InChI | InChI=1S/C5H3Cl3FN4O3PS/c6-3(14)2(11-16-1-9)4-10-5(18-13-4)12-17(7,8)15/h1H2,(H,10,12,13,15)/b11-2- |
| InChIKey | FCIIYNIHQYHBMJ-FUQNDXKWSA-N |
| XLogP | 2.95 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|