C12H10N4O4S — CID 54388519
2-(5-formamido-1,2,4-thiadiazol-3-yl)-2-phenylmethoxyiminoacetic acid (PubChem CID 54388519) has the molecular formula C12H10N4O4S and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-(5-formamido-1,2,4-thiadiazol-3-yl)-2-phenylmethoxyiminoacetic acid.
| Compound Name | 2-(5-formamido-1,2,4-thiadiazol-3-yl)-2-phenylmethoxyiminoacetic acid |
|---|---|
| PubChem CID | 54388519 |
| Molecular Formula | C12H10N4O4S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(5-formamido-1,2,4-thiadiazol-3-yl)-2-phenylmethoxyiminoacetic acid |
| SMILES | O=CNc1nc(C(=NOCc2ccccc2)C(=O)O)ns1 |
| InChI | InChI=1S/C12H10N4O4S/c17-7-13-12-14-10(16-21-12)9(11(18)19)15-20-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,18,19)(H,13,14,16,17) |
| InChIKey | VEYQUXCMNITWKR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|