About N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide
N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide (PubChem CID 135463679) has the molecular formula C14H17N5O2
and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide |
| PubChem CID | 135463679 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide |
| SMILES | CCn1cnc(NC=O)c1/C(N)=N/OCc1ccccc1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-19-9-16-14(17-10-20)12(19)13(15)18-21-8-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H2,15,18)(H,17,20) |
| InChIKey | HMYZMZUNUHTBLQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide?
The IUPAC name of N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide (CID 135463679) is N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide.
What is the SMILES notation for N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide?
The canonical SMILES for N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide is CCn1cnc(NC=O)c1/C(N)=N/OCc1ccccc1.
What is the InChIKey of N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide?
The InChIKey is HMYZMZUNUHTBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O2/c1-2-19-9-16-14(17-10-20)12(19)13(15)18-21-8-11-6-4-3-5-7-11/h3-7,9-10H,2,8H2,1H3,(H2,15,18)(H,17,20).
What are the key properties of N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide?
N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide has a molecular weight of 287.32 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-ethyl-5-[(Z)-N'-phenylmethoxycarbamimidoyl]imidazol-4-yl]formamide is sourced from PubChem (CID 135463679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).