C12H18Cl2N4O4S — CID 86743943
tert-butyl 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoate;hydrochloride (PubChem CID 86743943) has the molecular formula C12H18Cl2N4O4S and a molecular weight of 385.27 g/mol. Its IUPAC name is tert-butyl 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoate;hydrochloride.
| Compound Name | tert-butyl 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 86743943 |
| Molecular Formula | C12H18Cl2N4O4S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | tert-butyl 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-chloro-2-oxoethylidene]amino]oxy-2-methylpropanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)C(C)(C)O/N=C(/C(=O)Cl)c1nsc(N)n1.Cl |
| InChI | InChI=1S/C12H17ClN4O4S.ClH/c1-11(2,3)20-9(19)12(4,5)21-16-6(7(13)18)8-15-10(14)22-17-8;/h1-5H3,(H2,14,15,17);1H/b16-6-; |
| InChIKey | KHWQNZUGDVDKEA-NKBLJONXSA-N |
| XLogP | 2.15 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|