C8H10N4O4S — CID 18640128
2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 18640128) has the molecular formula C8H10N4O4S and a molecular weight of 258.26 g/mol. Its IUPAC name is 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 18640128 |
| Molecular Formula | C8H10N4O4S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-[(E)-[1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(/C=O)c1nsc(N)n1)C(=O)O |
| InChI | InChI=1S/C8H10N4O4S/c1-8(2,6(14)15)16-11-4(3-13)5-10-7(9)17-12-5/h3H,1-2H3,(H,14,15)(H2,9,10,12)/b11-4- |
| InChIKey | YAPFDHZEILQJBV-WCIBSUBMSA-N |
| XLogP | -0.10 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|