C9H12N4O2S — CID 173377652
(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoacetaldehyde (PubChem CID 173377652) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoacetaldehyde.
| Compound Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoacetaldehyde |
|---|---|
| PubChem CID | 173377652 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoacetaldehyde |
| SMILES | Nc1nc(/C(C=O)=N/OC2CCCC2)ns1 |
| InChI | InChI=1S/C9H12N4O2S/c10-9-11-8(13-16-9)7(5-14)12-15-6-3-1-2-4-6/h5-6H,1-4H2,(H2,10,11,13)/b12-7+ |
| InChIKey | AIXBIZSAFAKHBA-KPKJPENVSA-N |
| XLogP | 0.98 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|