C16H15N5O2S3 — CID 10835130
S-(1,3-benzothiazol-2-yl) (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoethanethioate (PubChem CID 10835130) has the molecular formula C16H15N5O2S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoethanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoethanethioate |
|---|---|
| PubChem CID | 10835130 |
| Molecular Formula | C16H15N5O2S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) (2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-cyclopentyloxyiminoethanethioate |
| SMILES | Nc1nc(/C(=N/OC2CCCC2)C(=O)Sc2nc3ccccc3s2)ns1 |
| InChI | InChI=1S/C16H15N5O2S3/c17-15-19-13(21-26-15)12(20-23-9-5-1-2-6-9)14(22)25-16-18-10-7-3-4-8-11(10)24-16/h3-4,7-9H,1-2,5-6H2,(H2,17,19,21)/b20-12- |
| InChIKey | HTDZFHWKKIMUQG-NDENLUEZSA-N |
| XLogP | 3.71 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|