C20H17Cl2N3O2S — CID 86620922
(2Z)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyloxyimino-2-(3,4-dichlorophenyl)acetamide (PubChem CID 86620922) has the molecular formula C20H17Cl2N3O2S and a molecular weight of 434.35 g/mol. Its IUPAC name is (2Z)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyloxyimino-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | (2Z)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyloxyimino-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 86620922 |
| Molecular Formula | C20H17Cl2N3O2S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (2Z)-N-(1,3-benzothiazol-2-yl)-2-cyclopentyloxyimino-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Nc1nc2ccccc2s1)/C(=N\OC1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O2S/c21-14-10-9-12(11-15(14)22)18(25-27-13-5-1-2-6-13)19(26)24-20-23-16-7-3-4-8-17(16)28-20/h3-4,7-11,13H,1-2,5-6H2,(H,23,24,26)/b25-18- |
| InChIKey | DPNJKTOTXMCLHI-BWAHOGKJSA-N |
| XLogP | 5.91 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|