C16H15ClFN3O3S2 — CID 143392607
(2E)-2-(3-chloro-4-methylsulfanylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(oxolan-3-yloxyimino)acetamide (PubChem CID 143392607) has the molecular formula C16H15ClFN3O3S2 and a molecular weight of 415.90 g/mol. Its IUPAC name is (2E)-2-(3-chloro-4-methylsulfanylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(oxolan-3-yloxyimino)acetamide.
| Compound Name | (2E)-2-(3-chloro-4-methylsulfanylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(oxolan-3-yloxyimino)acetamide |
|---|---|
| PubChem CID | 143392607 |
| Molecular Formula | C16H15ClFN3O3S2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | (2E)-2-(3-chloro-4-methylsulfanylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(oxolan-3-yloxyimino)acetamide |
| SMILES | CSc1ccc(/C(=N\OC2CCOC2)C(=O)Nc2ncc(F)s2)cc1Cl |
| InChI | InChI=1S/C16H15ClFN3O3S2/c1-25-12-3-2-9(6-11(12)17)14(21-24-10-4-5-23-8-10)15(22)20-16-19-7-13(18)26-16/h2-3,6-7,10H,4-5,8H2,1H3,(H,19,20,22)/b21-14+ |
| InChIKey | DBYBSISZXQANQW-KGENOOAVSA-N |
| XLogP | 3.81 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|