C19H24FN5O5S2 — CID 91142425
2-[4-[2-(dimethylamino)ethylsulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91142425) has the molecular formula C19H24FN5O5S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethylsulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-[4-[2-(dimethylamino)ethylsulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91142425 |
| Molecular Formula | C19H24FN5O5S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethylsulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CN(C)CCNS(=O)(=O)c1ccc(C(=NO[C@@H]2CCOC2)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C19H24FN5O5S2/c1-25(2)9-8-22-32(27,28)15-5-3-13(4-6-15)17(24-30-14-7-10-29-12-14)18(26)23-19-21-11-16(20)31-19/h3-6,11,14,22H,7-10,12H2,1-2H3,(H,21,23,26)/t14-/m1/s1 |
| InChIKey | XAUGOFMIYOWCIG-CQSZACIVSA-N |
| XLogP | 1.27 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|