C17H19FN4O3S2 — CID 143392777
(2E)-2-[4-(2-aminoethylsulfanyl)phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 143392777) has the molecular formula C17H19FN4O3S2 and a molecular weight of 410.50 g/mol. Its IUPAC name is (2E)-2-[4-(2-aminoethylsulfanyl)phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | (2E)-2-[4-(2-aminoethylsulfanyl)phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 143392777 |
| Molecular Formula | C17H19FN4O3S2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2E)-2-[4-(2-aminoethylsulfanyl)phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | NCCSc1ccc(/C(=N\O[C@@H]2CCOC2)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C17H19FN4O3S2/c18-14-9-20-17(27-14)21-16(23)15(22-25-12-5-7-24-10-12)11-1-3-13(4-2-11)26-8-6-19/h1-4,9,12H,5-8,10,19H2,(H,20,21,23)/b22-15+/t12-/m1/s1 |
| InChIKey | LEVHKJRMMFZOSN-SPZKXHQHSA-N |
| XLogP | 2.48 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|