C19H24FN4O7S3+ — CID 143392303
[(1,1-dioxo-1,4-thiazinan-4-yl)-[4-[(E)-C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]-hydroxy-λ4-sulfanyl]oxidanium (PubChem CID 143392303) has the molecular formula C19H24FN4O7S3+ and a molecular weight of 535.62 g/mol. Its IUPAC name is [(1,1-dioxo-1,4-thiazinan-4-yl)-[4-[(E)-C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]-hydroxy-λ4-sulfanyl]oxidanium.
| Compound Name | [(1,1-dioxo-1,4-thiazinan-4-yl)-[4-[(E)-C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]-hydroxy-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 143392303 |
| Molecular Formula | C19H24FN4O7S3+ |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | [(1,1-dioxo-1,4-thiazinan-4-yl)-[4-[(E)-C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]-hydroxy-λ4-sulfanyl]oxidanium |
| SMILES | O=C(Nc1ncc(F)s1)/C(=N/O[C@@H]1CCOC1)c1ccc(S(O)([OH2+])N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C19H23FN4O7S3/c20-16-11-21-19(32-16)22-18(25)17(23-31-14-5-8-30-12-14)13-1-3-15(4-2-13)34(28,29)24-6-9-33(26,27)10-7-24/h1-4,11,14,28-29H,5-10,12H2,(H,21,22,25)/p+1/b23-17+/t14-/m1/s1 |
| InChIKey | NKLUOGJMNVGQIX-IHLBYEDJSA-O |
| XLogP | 1.35 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|