C20H24FN5O7S3 — CID 90692501
N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-(4-sulfamoylpiperidin-1-yl)sulfonylphenyl]acetamide (PubChem CID 90692501) has the molecular formula C20H24FN5O7S3 and a molecular weight of 561.64 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-(4-sulfamoylpiperidin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-(4-sulfamoylpiperidin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 90692501 |
| Molecular Formula | C20H24FN5O7S3 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-(4-sulfamoylpiperidin-1-yl)sulfonylphenyl]acetamide |
| SMILES | NS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(C(=NO[C@@H]3CCOC3)C(=O)Nc3ncc(F)s3)cc2)CC1 |
| InChI | InChI=1S/C20H24FN5O7S3/c21-17-11-23-20(34-17)24-19(27)18(25-33-14-7-10-32-12-14)13-1-3-16(4-2-13)36(30,31)26-8-5-15(6-9-26)35(22,28)29/h1-4,11,14-15H,5-10,12H2,(H2,22,28,29)(H,23,24,27)/t14-/m1/s1 |
| InChIKey | VEWFXYTWSWRPGE-CQSZACIVSA-N |
| XLogP | 0.87 |
| TPSA | 170.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|