C22H26FN3O6S2 — CID 90733237
2-[(1R,3R)-3-ethoxycyclopentyl]oxyimino-N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 90733237) has the molecular formula C22H26FN3O6S2 and a molecular weight of 511.60 g/mol. Its IUPAC name is 2-[(1R,3R)-3-ethoxycyclopentyl]oxyimino-N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | 2-[(1R,3R)-3-ethoxycyclopentyl]oxyimino-N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 90733237 |
| Molecular Formula | C22H26FN3O6S2 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 2-[(1R,3R)-3-ethoxycyclopentyl]oxyimino-N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | CCO[C@@H]1CC[C@@H](ON=C(C(=O)Nc2ncc(F)s2)c2ccc(S(=O)(=O)[C@H]3CCOC3)cc2)C1 |
| InChI | InChI=1S/C22H26FN3O6S2/c1-2-31-15-5-6-16(11-15)32-26-20(21(27)25-22-24-12-19(23)33-22)14-3-7-17(8-4-14)34(28,29)18-9-10-30-13-18/h3-4,7-8,12,15-16,18H,2,5-6,9-11,13H2,1H3,(H,24,25,27)/t15-,16-,18+/m1/s1 |
| InChIKey | JGUKVRYQWPXDNI-NUJGCVRESA-N |
| XLogP | 3.16 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|