C24H30FN5O7S2 — CID 91268223
tert-butyl 4-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 91268223) has the molecular formula C24H30FN5O7S2 and a molecular weight of 583.66 g/mol. Its IUPAC name is tert-butyl 4-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 91268223 |
| Molecular Formula | C24H30FN5O7S2 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | tert-butyl 4-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc(C(=NO[C@@H]3CCOC3)C(=O)Nc3ncc(F)s3)cc2)CC1 |
| InChI | InChI=1S/C24H30FN5O7S2/c1-24(2,3)36-23(32)29-9-11-30(12-10-29)39(33,34)18-6-4-16(5-7-18)20(28-37-17-8-13-35-15-17)21(31)27-22-26-14-19(25)38-22/h4-7,14,17H,8-13,15H2,1-3H3,(H,26,27,31)/t17-/m1/s1 |
| InChIKey | YOCKKDOLBLMYJW-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|