C26H33N5O7S2 — CID 91389955
methyl 4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-1,4-diazepane-1-carboxylate (PubChem CID 91389955) has the molecular formula C26H33N5O7S2 and a molecular weight of 591.71 g/mol. Its IUPAC name is methyl 4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-1,4-diazepane-1-carboxylate.
| Compound Name | methyl 4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 91389955 |
| Molecular Formula | C26H33N5O7S2 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | methyl 4-[[2-[[2-(4-cyclopropylsulfonylphenyl)-2-[(3R)-oxolan-3-yl]oxyiminoacetyl]amino]-1,3-thiazol-5-yl]methyl]-1,4-diazepane-1-carboxylate |
| SMILES | COC(=O)N1CCCN(Cc2cnc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)s2)CC1 |
| InChI | InChI=1S/C26H33N5O7S2/c1-36-26(33)31-11-2-10-30(12-13-31)16-20-15-27-25(39-20)28-24(32)23(29-38-19-9-14-37-17-19)18-3-5-21(6-4-18)40(34,35)22-7-8-22/h3-6,15,19,22H,2,7-14,16-17H2,1H3,(H,27,28,32)/t19-/m1/s1 |
| InChIKey | ONKXUKOMPDSMLI-LJQANCHMSA-N |
| XLogP | 2.50 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|