C21H22N6O5S3 — CID 91291332
2-(4-cyclopropylsulfonylphenyl)-N-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91291332) has the molecular formula C21H22N6O5S3 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91291332 |
| Molecular Formula | C21H22N6O5S3 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazol-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | Cn1cnnc1Sc1cnc(NC(=O)C(=NO[C@@H]2CCOC2)c2ccc(S(=O)(=O)C3CC3)cc2)s1 |
| InChI | InChI=1S/C21H22N6O5S3/c1-27-12-23-25-21(27)34-17-10-22-20(33-17)24-19(28)18(26-32-14-8-9-31-11-14)13-2-4-15(5-3-13)35(29,30)16-6-7-16/h2-5,10,12,14,16H,6-9,11H2,1H3,(H,22,24,28)/t14-/m1/s1 |
| InChIKey | HCGQFMPHELOMOF-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|