C22H25N6O5S2+ — CID 143392760
(2E)-2-(4-cyclopropylsulfonylphenyl)-N-[6-(dimethylamino)-[1,3]thiazolo[4,5-b]pyrazin-7-ium-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 143392760) has the molecular formula C22H25N6O5S2+ and a molecular weight of 517.61 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[6-(dimethylamino)-[1,3]thiazolo[4,5-b]pyrazin-7-ium-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[6-(dimethylamino)-[1,3]thiazolo[4,5-b]pyrazin-7-ium-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 143392760 |
| Molecular Formula | C22H25N6O5S2+ |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[6-(dimethylamino)-[1,3]thiazolo[4,5-b]pyrazin-7-ium-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CN(C)c1cnc2nc(NC(=O)/C(=N/O[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2[nH+]1 |
| InChI | InChI=1S/C22H24N6O5S2/c1-28(2)17-11-23-19-21(24-17)34-22(25-19)26-20(29)18(27-33-14-9-10-32-12-14)13-3-5-15(6-4-13)35(30,31)16-7-8-16/h3-6,11,14,16H,7-10,12H2,1-2H3,(H,23,25,26,29)/p+1/b27-18+/t14-/m1/s1 |
| InChIKey | BBVMLHXTBQIVGP-DFCFRIHASA-O |
| XLogP | 1.66 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|