C25H29N5O6S2 — CID 91529865
2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91529865) has the molecular formula C25H29N5O6S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91529865 |
| Molecular Formula | C25H29N5O6S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | CN(C)CCOc1ccc2nc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C25H29N5O6S2/c1-30(2)12-14-35-21-10-9-20-24(27-21)37-25(26-20)28-23(31)22(29-36-17-11-13-34-15-17)16-3-5-18(6-4-16)38(32,33)19-7-8-19/h3-6,9-10,17,19H,7-8,11-15H2,1-2H3,(H,26,28,31)/t17-/m1/s1 |
| InChIKey | GOHPZYGLWFAFFH-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|