C24H26N4O8S2 — CID 91339555
N-[5-(2-hydroxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 91339555) has the molecular formula C24H26N4O8S2 and a molecular weight of 562.63 g/mol. Its IUPAC name is N-[5-(2-hydroxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[5-(2-hydroxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 91339555 |
| Molecular Formula | C24H26N4O8S2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | N-[5-(2-hydroxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(3R)-oxolan-3-yl]oxyimino-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | O=C(Nc1nc2ccc(OCCO)nc2s1)C(=NO[C@@H]1CCOC1)c1ccc(S(=O)(=O)[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C24H26N4O8S2/c29-9-12-35-20-6-5-19-23(26-20)37-24(25-19)27-22(30)21(28-36-16-7-10-33-13-16)15-1-3-17(4-2-15)38(31,32)18-8-11-34-14-18/h1-6,16,18,29H,7-14H2,(H,25,27,30)/t16-,18+/m1/s1 |
| InChIKey | WFLYNKHGBSNLSN-AEFFLSMTSA-N |
| XLogP | 1.77 |
| TPSA | 158.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|