C21H23N5O7S2 — CID 123932735
2-[4-[dihydroxy-(2-oxoethylamino)-λ4-sulfanyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 123932735) has the molecular formula C21H23N5O7S2 and a molecular weight of 521.58 g/mol. Its IUPAC name is 2-[4-[dihydroxy-(2-oxoethylamino)-λ4-sulfanyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-[4-[dihydroxy-(2-oxoethylamino)-λ4-sulfanyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 123932735 |
| Molecular Formula | C21H23N5O7S2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2-[4-[dihydroxy-(2-oxoethylamino)-λ4-sulfanyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | COc1ccc2nc(NC(=O)C(=NO[C@@H]3CCOC3)c3ccc(S(O)(O)NCC=O)cc3)sc2n1 |
| InChI | InChI=1S/C21H23N5O7S2/c1-31-17-7-6-16-20(24-17)34-21(23-16)25-19(28)18(26-33-14-8-11-32-12-14)13-2-4-15(5-3-13)35(29,30)22-9-10-27/h2-7,10,14,22,29-30H,8-9,11-12H2,1H3,(H,23,25,28)/t14-/m1/s1 |
| InChIKey | TZORKTBDORFHIL-CQSZACIVSA-N |
| XLogP | 2.66 |
| TPSA | 164.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|