C22H24N4O7S2 — CID 91303744
2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide (PubChem CID 91303744) has the molecular formula C22H24N4O7S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide.
| Compound Name | 2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 91303744 |
| Molecular Formula | C22H24N4O7S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[(2R)-1-hydroxypropan-2-yl]oxyimino-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-[(3S)-oxolan-3-yl]sulfonylphenyl]acetamide |
| SMILES | COc1ccc2nc(NC(=O)C(=NO[C@H](C)CO)c3ccc(S(=O)(=O)[C@H]4CCOC4)cc3)sc2n1 |
| InChI | InChI=1S/C22H24N4O7S2/c1-13(11-27)33-26-19(14-3-5-15(6-4-14)35(29,30)16-9-10-32-12-16)20(28)25-22-23-17-7-8-18(31-2)24-21(17)34-22/h3-8,13,16,27H,9-12H2,1-2H3,(H,23,25,28)/t13-,16+/m1/s1 |
| InChIKey | NTGXWXFNPISVGC-CJNGLKHVSA-N |
| XLogP | 2.00 |
| TPSA | 149.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|