C24H29N5O6S2 — CID 74384019
2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(3-hydroxypropoxyimino)acetamide (PubChem CID 74384019) has the molecular formula C24H29N5O6S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(3-hydroxypropoxyimino)acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(3-hydroxypropoxyimino)acetamide |
|---|---|
| PubChem CID | 74384019 |
| Molecular Formula | C24H29N5O6S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(3-hydroxypropoxyimino)acetamide |
| SMILES | CN(C)CCOc1ccc2nc(NC(=O)C(=NOCCCO)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C24H29N5O6S2/c1-29(2)12-15-34-20-11-10-19-23(26-20)36-24(25-19)27-22(31)21(28-35-14-3-13-30)16-4-6-17(7-5-16)37(32,33)18-8-9-18/h4-7,10-11,18,30H,3,8-9,12-15H2,1-2H3,(H,25,27,31) |
| InChIKey | NYCBLUZYJZSGTO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|