C29H29N7O7S3 — CID 25000905
(2E)-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1,1,3-trioxo-1,2-benzothiazol-5-yl)hydrazinylidene]acetamide (PubChem CID 25000905) has the molecular formula C29H29N7O7S3 and a molecular weight of 683.79 g/mol. Its IUPAC name is (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1,1,3-trioxo-1,2-benzothiazol-5-yl)hydrazinylidene]acetamide.
| Compound Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1,1,3-trioxo-1,2-benzothiazol-5-yl)hydrazinylidene]acetamide |
|---|---|
| PubChem CID | 25000905 |
| Molecular Formula | C29H29N7O7S3 |
| Molecular Weight | 683.79 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | (2E)-2-(4-cyclopropylsulfonylphenyl)-N-[5-[3-(dimethylamino)propoxy]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-[(1,1,3-trioxo-1,2-benzothiazol-5-yl)hydrazinylidene]acetamide |
| SMILES | CN(C)CCCOc1ccc2nc(NC(=O)/C(=N/Nc3ccc4c(c3)C(=O)NS4(=O)=O)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C29H29N7O7S3/c1-36(2)14-3-15-43-24-13-11-22-28(31-24)44-29(30-22)32-27(38)25(17-4-7-19(8-5-17)45(39,40)20-9-10-20)34-33-18-6-12-23-21(16-18)26(37)35-46(23,41)42/h4-8,11-13,16,20,33H,3,9-10,14-15H2,1-2H3,(H,35,37)(H,30,32,38)/b34-25+ |
| InChIKey | QJEGGPNXBYILOG-YQCHCMBFSA-N |
| XLogP | 2.84 |
| TPSA | 189.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|