C26H28N8O4S2 — CID 76630653
2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(pyrimidin-2-ylmethoxyimino)acetamide (PubChem CID 76630653) has the molecular formula C26H28N8O4S2 and a molecular weight of 580.70 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(pyrimidin-2-ylmethoxyimino)acetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(pyrimidin-2-ylmethoxyimino)acetamide |
|---|---|
| PubChem CID | 76630653 |
| Molecular Formula | C26H28N8O4S2 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-[5-[2-(dimethylamino)ethylamino]-[1,3]thiazolo[5,4-b]pyridin-2-yl]-2-(pyrimidin-2-ylmethoxyimino)acetamide |
| SMILES | CN(C)CCNc1ccc2nc(NC(=O)C(=NOCc3ncccn3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C26H28N8O4S2/c1-34(2)15-14-29-21-11-10-20-25(31-21)39-26(30-20)32-24(35)23(33-38-16-22-27-12-3-13-28-22)17-4-6-18(7-5-17)40(36,37)19-8-9-19/h3-7,10-13,19H,8-9,14-16H2,1-2H3,(H,29,31)(H,30,32,35) |
| InChIKey | KGGXLUIUWGINSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 151.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|